C32H27N7O2 — CID 45269166
3-[1-(4-imidazol-1-ylbutyl)pyrazolo[5,4-b]pyridin-3-yl]-4-(1-methylindol-3-yl)-1-phenylpyrrole-2,5-dione (PubChem CID 45269166) has the molecular formula C32H27N7O2 and a molecular weight of 541.62 g/mol. Its IUPAC name is 3-[1-(4-imidazol-1-ylbutyl)pyrazolo[5,4-b]pyridin-3-yl]-4-(1-methylindol-3-yl)-1-phenylpyrrole-2,5-dione.
| Compound Name | 3-[1-(4-imidazol-1-ylbutyl)pyrazolo[5,4-b]pyridin-3-yl]-4-(1-methylindol-3-yl)-1-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 45269166 |
| Molecular Formula | C32H27N7O2 |
| Molecular Weight | 541.62 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | 3-[1-(4-imidazol-1-ylbutyl)pyrazolo[5,4-b]pyridin-3-yl]-4-(1-methylindol-3-yl)-1-phenylpyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3nn(CCCCn4ccnc4)c4ncccc34)C(=O)N(c3ccccc3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C32H27N7O2/c1-36-20-25(23-12-5-6-14-26(23)36)27-28(32(41)39(31(27)40)22-10-3-2-4-11-22)29-24-13-9-15-34-30(24)38(35-29)18-8-7-17-37-19-16-33-21-37/h2-6,9-16,19-21H,7-8,17-18H2,1H3 |
| InChIKey | HCDLHDDEQURONN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 90.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|