C18H25N3O — CID 45269177
N-[2-(2-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indol-10-yl)ethyl]butanamide (PubChem CID 45269177) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is N-[2-(2-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indol-10-yl)ethyl]butanamide.
| Compound Name | N-[2-(2-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indol-10-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 45269177 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | N-[2-(2-methyl-3,4-dihydro-1H-pyrazino[1,2-a]indol-10-yl)ethyl]butanamide |
| SMILES | CCCC(=O)NCCc1c2n(c3ccccc13)CCN(C)C2 |
| InChI | InChI=1S/C18H25N3O/c1-3-6-18(22)19-10-9-15-14-7-4-5-8-16(14)21-12-11-20(2)13-17(15)21/h4-5,7-8H,3,6,9-13H2,1-2H3,(H,19,22) |
| InChIKey | LIYWRBNVQUGPBF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|