C25H34N2O2 — CID 4526920
4-[2-[4-(4-methoxyphenyl)-2,2-dimethyloxan-4-yl]ethyliminomethyl]-N,N-dimethylaniline (PubChem CID 4526920) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 4-[2-[4-(4-methoxyphenyl)-2,2-dimethyloxan-4-yl]ethyliminomethyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[4-(4-methoxyphenyl)-2,2-dimethyloxan-4-yl]ethyliminomethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 4526920 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 4-[2-[4-(4-methoxyphenyl)-2,2-dimethyloxan-4-yl]ethyliminomethyl]-N,N-dimethylaniline |
| SMILES | COc1ccc(C2(CC/N=C/c3ccc(N(C)C)cc3)CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C25H34N2O2/c1-24(2)19-25(15-17-29-24,21-8-12-23(28-5)13-9-21)14-16-26-18-20-6-10-22(11-7-20)27(3)4/h6-13,18H,14-17,19H2,1-5H3/b26-18+ |
| InChIKey | FIVMSMFFNOEBKL-NLRVBDNBSA-N |
| XLogP | 5.10 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|