C19H24O3 — CID 45269383
(7R)-7-phenylspiro[1,2,4-trioxepane-3,2'-adamantane] (PubChem CID 45269383) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (7R)-7-phenylspiro[1,2,4-trioxepane-3,2'-adamantane].
| Compound Name | (7R)-7-phenylspiro[1,2,4-trioxepane-3,2'-adamantane] |
|---|---|
| PubChem CID | 45269383 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (7R)-7-phenylspiro[1,2,4-trioxepane-3,2'-adamantane] |
| SMILES | c1ccc([C@H]2CCOC3(OO2)C2CC4CC(C2)CC3C4)cc1 |
| InChI | InChI=1S/C19H24O3/c1-2-4-15(5-3-1)18-6-7-20-19(22-21-18)16-9-13-8-14(11-16)12-17(19)10-13/h1-5,13-14,16-18H,6-12H2/t13?,14?,16?,17?,18-,19?/m1/s1 |
| InChIKey | YFRKDIGAENYLML-XQPWLTOXSA-N |
| XLogP | 4.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|