C25H30N4O7 — CID 45269519
(6E)-6-[[6-(4-methoxyphenyl)-4-[(2-methoxyphenyl)methyl]pyridazin-3-yl]hydrazinylidene]hexane-1,2,3,4,5-pentol (PubChem CID 45269519) has the molecular formula C25H30N4O7 and a molecular weight of 498.54 g/mol. Its IUPAC name is (6E)-6-[[6-(4-methoxyphenyl)-4-[(2-methoxyphenyl)methyl]pyridazin-3-yl]hydrazinylidene]hexane-1,2,3,4,5-pentol.
| Compound Name | (6E)-6-[[6-(4-methoxyphenyl)-4-[(2-methoxyphenyl)methyl]pyridazin-3-yl]hydrazinylidene]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 45269519 |
| Molecular Formula | C25H30N4O7 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | (6E)-6-[[6-(4-methoxyphenyl)-4-[(2-methoxyphenyl)methyl]pyridazin-3-yl]hydrazinylidene]hexane-1,2,3,4,5-pentol |
| SMILES | COc1ccc(-c2cc(Cc3ccccc3OC)c(N/N=C/C(O)C(O)C(O)C(O)CO)nn2)cc1 |
| InChI | InChI=1S/C25H30N4O7/c1-35-18-9-7-15(8-10-18)19-12-17(11-16-5-3-4-6-22(16)36-2)25(29-27-19)28-26-13-20(31)23(33)24(34)21(32)14-30/h3-10,12-13,20-21,23-24,30-34H,11,14H2,1-2H3,(H,28,29)/b26-13+ |
| InChIKey | NSZQOYJTIQTYRV-LGJNPRDNSA-N |
| XLogP | 0.59 |
| TPSA | 169.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|