C32H36N4O9 — CID 45269520
[(5E)-2,3,4-triacetyloxy-5-[[4-[(2-methoxyphenyl)methyl]-6-(4-methylphenyl)pyridazin-3-yl]hydrazinylidene]pentyl] acetate (PubChem CID 45269520) has the molecular formula C32H36N4O9 and a molecular weight of 620.66 g/mol. Its IUPAC name is [(5E)-2,3,4-triacetyloxy-5-[[4-[(2-methoxyphenyl)methyl]-6-(4-methylphenyl)pyridazin-3-yl]hydrazinylidene]pentyl] acetate.
| Compound Name | [(5E)-2,3,4-triacetyloxy-5-[[4-[(2-methoxyphenyl)methyl]-6-(4-methylphenyl)pyridazin-3-yl]hydrazinylidene]pentyl] acetate |
|---|---|
| PubChem CID | 45269520 |
| Molecular Formula | C32H36N4O9 |
| Molecular Weight | 620.66 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | [(5E)-2,3,4-triacetyloxy-5-[[4-[(2-methoxyphenyl)methyl]-6-(4-methylphenyl)pyridazin-3-yl]hydrazinylidene]pentyl] acetate |
| SMILES | COc1ccccc1Cc1cc(-c2ccc(C)cc2)nnc1N/N=C/C(OC(C)=O)C(OC(C)=O)C(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C32H36N4O9/c1-19-11-13-24(14-12-19)27-16-26(15-25-9-7-8-10-28(25)41-6)32(36-34-27)35-33-17-29(43-21(3)38)31(45-23(5)40)30(44-22(4)39)18-42-20(2)37/h7-14,16-17,29-31H,15,18H2,1-6H3,(H,35,36)/b33-17+ |
| InChIKey | VPVAEVLGIVTQRL-ATZGPIRCSA-N |
| XLogP | 3.81 |
| TPSA | 164.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.66 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|