About (E)-3-methyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine
(E)-3-methyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine (PubChem CID 45269525) has the molecular formula C27H30N2O
and a molecular weight of 398.55 g/mol. Its IUPAC name is (E)-3-methyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine.
Molecular Properties
| Compound Name | (E)-3-methyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine |
| PubChem CID | 45269525 |
| Molecular Formula | C27H30N2O |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | (E)-3-methyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine |
| SMILES | Cc1ccc(C2C/C(=N\OCc3ccccc3)C(C)C(c3ccc(C)cc3)N2)cc1 |
| InChI | InChI=1S/C27H30N2O/c1-19-9-13-23(14-10-19)26-17-25(29-30-18-22-7-5-4-6-8-22)21(3)27(28-26)24-15-11-20(2)12-16-24/h4-16,21,26-28H,17-18H2,1-3H3/b29-25+ |
| InChIKey | DXXNLEIMZJWKNX-XLVZBRSZSA-N |
| XLogP | 6.29 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-methyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-methyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine?
The IUPAC name of (E)-3-methyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine (CID 45269525) is (E)-3-methyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine.
What is the SMILES notation for (E)-3-methyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine?
The canonical SMILES for (E)-3-methyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine is Cc1ccc(C2C/C(=N\OCc3ccccc3)C(C)C(c3ccc(C)cc3)N2)cc1.
What is the InChIKey of (E)-3-methyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine?
The InChIKey is DXXNLEIMZJWKNX-XLVZBRSZSA-N. The full InChI is InChI=1S/C27H30N2O/c1-19-9-13-23(14-10-19)26-17-25(29-30-18-22-7-5-4-6-8-22)21(3)27(28-26)24-15-11-20(2)12-16-24/h4-16,21,26-28H,17-18H2,1-3H3/b29-25+.
What are the key properties of (E)-3-methyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine?
(E)-3-methyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine has a molecular weight of 398.55 g/mol, XLogP of 6.29, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-methyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine is sourced from PubChem (CID 45269525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).