About 3,5-dimethyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine
3,5-dimethyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine (PubChem CID 45269526) has the molecular formula C28H32N2O
and a molecular weight of 412.58 g/mol. Its IUPAC name is 3,5-dimethyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine.
Molecular Properties
| Compound Name | 3,5-dimethyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine |
| PubChem CID | 45269526 |
| Molecular Formula | C28H32N2O |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 3,5-dimethyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine |
| SMILES | Cc1ccc(C2NC(c3ccc(C)cc3)C(C)C(=NOCc3ccccc3)C2C)cc1 |
| InChI | InChI=1S/C28H32N2O/c1-19-10-14-24(15-11-19)27-21(3)26(30-31-18-23-8-6-5-7-9-23)22(4)28(29-27)25-16-12-20(2)13-17-25/h5-17,21-22,27-29H,18H2,1-4H3 |
| InChIKey | VDBGEUWGVDZUOW-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine?
The IUPAC name of 3,5-dimethyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine (CID 45269526) is 3,5-dimethyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine.
What is the SMILES notation for 3,5-dimethyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine?
The canonical SMILES for 3,5-dimethyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine is Cc1ccc(C2NC(c3ccc(C)cc3)C(C)C(=NOCc3ccccc3)C2C)cc1.
What is the InChIKey of 3,5-dimethyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine?
The InChIKey is VDBGEUWGVDZUOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H32N2O/c1-19-10-14-24(15-11-19)27-21(3)26(30-31-18-23-8-6-5-7-9-23)22(4)28(29-27)25-16-12-20(2)13-17-25/h5-17,21-22,27-29H,18H2,1-4H3.
What are the key properties of 3,5-dimethyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine?
3,5-dimethyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine has a molecular weight of 412.58 g/mol, XLogP of 6.53, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-2,6-bis(4-methylphenyl)-N-phenylmethoxypiperidin-4-imine is sourced from PubChem (CID 45269526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).