About (Z)-3-methyl-2,6-diphenyl-N-phenylmethoxyoxan-4-imine
(Z)-3-methyl-2,6-diphenyl-N-phenylmethoxyoxan-4-imine (PubChem CID 45269527) has the molecular formula C25H25NO2
and a molecular weight of 371.48 g/mol. Its IUPAC name is (Z)-3-methyl-2,6-diphenyl-N-phenylmethoxyoxan-4-imine.
Molecular Properties
| Compound Name | (Z)-3-methyl-2,6-diphenyl-N-phenylmethoxyoxan-4-imine |
| PubChem CID | 45269527 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (Z)-3-methyl-2,6-diphenyl-N-phenylmethoxyoxan-4-imine |
| SMILES | CC1/C(=N\OCc2ccccc2)CC(c2ccccc2)OC1c1ccccc1 |
| InChI | InChI=1S/C25H25NO2/c1-19-23(26-27-18-20-11-5-2-6-12-20)17-24(21-13-7-3-8-14-21)28-25(19)22-15-9-4-10-16-22/h2-16,19,24-25H,17-18H2,1H3/b26-23- |
| InChIKey | DAMINAFEYWJFDP-RWEWTDSWSA-N |
| XLogP | 6.10 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-methyl-2,6-diphenyl-N-phenylmethoxyoxan-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-methyl-2,6-diphenyl-N-phenylmethoxyoxan-4-imine?
The IUPAC name of (Z)-3-methyl-2,6-diphenyl-N-phenylmethoxyoxan-4-imine (CID 45269527) is (Z)-3-methyl-2,6-diphenyl-N-phenylmethoxyoxan-4-imine.
What is the SMILES notation for (Z)-3-methyl-2,6-diphenyl-N-phenylmethoxyoxan-4-imine?
The canonical SMILES for (Z)-3-methyl-2,6-diphenyl-N-phenylmethoxyoxan-4-imine is CC1/C(=N\OCc2ccccc2)CC(c2ccccc2)OC1c1ccccc1.
What is the InChIKey of (Z)-3-methyl-2,6-diphenyl-N-phenylmethoxyoxan-4-imine?
The InChIKey is DAMINAFEYWJFDP-RWEWTDSWSA-N. The full InChI is InChI=1S/C25H25NO2/c1-19-23(26-27-18-20-11-5-2-6-12-20)17-24(21-13-7-3-8-14-21)28-25(19)22-15-9-4-10-16-22/h2-16,19,24-25H,17-18H2,1H3/b26-23-.
What are the key properties of (Z)-3-methyl-2,6-diphenyl-N-phenylmethoxyoxan-4-imine?
(Z)-3-methyl-2,6-diphenyl-N-phenylmethoxyoxan-4-imine has a molecular weight of 371.48 g/mol, XLogP of 6.10, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-methyl-2,6-diphenyl-N-phenylmethoxyoxan-4-imine is sourced from PubChem (CID 45269527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).