C23H19N3O2 — CID 45269536
6,7-dimethoxy-3-(3-pyridin-3-ylphenyl)-1,4-dihydroindeno[2,1-d]pyrazole (PubChem CID 45269536) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is 6,7-dimethoxy-3-(3-pyridin-3-ylphenyl)-1,4-dihydroindeno[2,1-d]pyrazole.
| Compound Name | 6,7-dimethoxy-3-(3-pyridin-3-ylphenyl)-1,4-dihydroindeno[2,1-d]pyrazole |
|---|---|
| PubChem CID | 45269536 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 6,7-dimethoxy-3-(3-pyridin-3-ylphenyl)-1,4-dihydroindeno[2,1-d]pyrazole |
| SMILES | COc1cc2c(cc1OC)-c1[nH]nc(-c3cccc(-c4cccnc4)c3)c1C2 |
| InChI | InChI=1S/C23H19N3O2/c1-27-20-11-17-10-19-22(25-26-23(19)18(17)12-21(20)28-2)15-6-3-5-14(9-15)16-7-4-8-24-13-16/h3-9,11-13H,10H2,1-2H3,(H,25,26) |
| InChIKey | QCRWSRHBUBCGNF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |