C23H18F3N3O4 — CID 45269545
8-(furan-2-yl)-1,3-dimethyl-5-(2,3,4-trifluorophenyl)-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 45269545) has the molecular formula C23H18F3N3O4 and a molecular weight of 457.41 g/mol. Its IUPAC name is 8-(furan-2-yl)-1,3-dimethyl-5-(2,3,4-trifluorophenyl)-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | 8-(furan-2-yl)-1,3-dimethyl-5-(2,3,4-trifluorophenyl)-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 45269545 |
| Molecular Formula | C23H18F3N3O4 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 8-(furan-2-yl)-1,3-dimethyl-5-(2,3,4-trifluorophenyl)-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)C(c1ccc(F)c(F)c1F)C1=C(CC(c3ccco3)CC1=O)N2 |
| InChI | InChI=1S/C23H18F3N3O4/c1-28-21-18(22(31)29(2)23(28)32)16(11-5-6-12(24)20(26)19(11)25)17-13(27-21)8-10(9-14(17)30)15-4-3-7-33-15/h3-7,10,16,27H,8-9H2,1-2H3 |
| InChIKey | JIKGEGASFPDXCW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 86.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|