C32H50N4O7 — CID 45269864
ethenyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-[4-(phenylmethoxycarbonylamino)butanoylamino]pentanoyl]amino]pentanoyl]amino]pentanoate (PubChem CID 45269864) has the molecular formula C32H50N4O7 and a molecular weight of 602.77 g/mol. Its IUPAC name is ethenyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-[4-(phenylmethoxycarbonylamino)butanoylamino]pentanoyl]amino]pentanoyl]amino]pentanoate.
| Compound Name | ethenyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-[4-(phenylmethoxycarbonylamino)butanoylamino]pentanoyl]amino]pentanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 45269864 |
| Molecular Formula | C32H50N4O7 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.37 |
| IUPAC Name | ethenyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-[4-(phenylmethoxycarbonylamino)butanoylamino]pentanoyl]amino]pentanoyl]amino]pentanoate |
| SMILES | C=COC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H50N4O7/c1-8-42-31(40)27(19-23(6)7)36-30(39)26(18-22(4)5)35-29(38)25(17-21(2)3)34-28(37)15-12-16-33-32(41)43-20-24-13-10-9-11-14-24/h8-11,13-14,21-23,25-27H,1,12,15-20H2,2-7H3,(H,33,41)(H,34,37)(H,35,38)(H,36,39)/t25-,26-,27-/m0/s1 |
| InChIKey | UWWOBRJYAWTOIA-QKDODKLFSA-N |
| XLogP | 3.97 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|