C33H52N4O7 — CID 45269865
ethenyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-[5-(phenylmethoxycarbonylamino)pentanoylamino]pentanoyl]amino]pentanoyl]amino]pentanoate (PubChem CID 45269865) has the molecular formula C33H52N4O7 and a molecular weight of 616.80 g/mol. Its IUPAC name is ethenyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-[5-(phenylmethoxycarbonylamino)pentanoylamino]pentanoyl]amino]pentanoyl]amino]pentanoate.
| Compound Name | ethenyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-[5-(phenylmethoxycarbonylamino)pentanoylamino]pentanoyl]amino]pentanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 45269865 |
| Molecular Formula | C33H52N4O7 |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.38 |
| IUPAC Name | ethenyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-[5-(phenylmethoxycarbonylamino)pentanoylamino]pentanoyl]amino]pentanoyl]amino]pentanoate |
| SMILES | C=COC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)CCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H52N4O7/c1-8-43-32(41)28(20-24(6)7)37-31(40)27(19-23(4)5)36-30(39)26(18-22(2)3)35-29(38)16-12-13-17-34-33(42)44-21-25-14-10-9-11-15-25/h8-11,14-15,22-24,26-28H,1,12-13,16-21H2,2-7H3,(H,34,42)(H,35,38)(H,36,39)(H,37,40)/t26-,27-,28-/m0/s1 |
| InChIKey | JZOGASLQTBAGFW-KCHLEUMXSA-N |
| XLogP | 4.36 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|