About 2-[2-(2,6-dichloroanilino)phenyl]-N-methylsulfonylpropanamide
2-[2-(2,6-dichloroanilino)phenyl]-N-methylsulfonylpropanamide (PubChem CID 45269894) has the molecular formula C16H16Cl2N2O3S
and a molecular weight of 387.29 g/mol. Its IUPAC name is 2-[2-(2,6-dichloroanilino)phenyl]-N-methylsulfonylpropanamide.
Molecular Properties
| Compound Name | 2-[2-(2,6-dichloroanilino)phenyl]-N-methylsulfonylpropanamide |
| PubChem CID | 45269894 |
| Molecular Formula | C16H16Cl2N2O3S |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 2-[2-(2,6-dichloroanilino)phenyl]-N-methylsulfonylpropanamide |
| SMILES | CC(C(=O)NS(C)(=O)=O)c1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H16Cl2N2O3S/c1-10(16(21)20-24(2,22)23)11-6-3-4-9-14(11)19-15-12(17)7-5-8-13(15)18/h3-10,19H,1-2H3,(H,20,21) |
| InChIKey | ZNEWAVGEUAWOBQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(2,6-dichloroanilino)phenyl]-N-methylsulfonylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,6-dichloroanilino)phenyl]-N-methylsulfonylpropanamide?
The IUPAC name of 2-[2-(2,6-dichloroanilino)phenyl]-N-methylsulfonylpropanamide (CID 45269894) is 2-[2-(2,6-dichloroanilino)phenyl]-N-methylsulfonylpropanamide.
What is the SMILES notation for 2-[2-(2,6-dichloroanilino)phenyl]-N-methylsulfonylpropanamide?
The canonical SMILES for 2-[2-(2,6-dichloroanilino)phenyl]-N-methylsulfonylpropanamide is CC(C(=O)NS(C)(=O)=O)c1ccccc1Nc1c(Cl)cccc1Cl.
What is the InChIKey of 2-[2-(2,6-dichloroanilino)phenyl]-N-methylsulfonylpropanamide?
The InChIKey is ZNEWAVGEUAWOBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Cl2N2O3S/c1-10(16(21)20-24(2,22)23)11-6-3-4-9-14(11)19-15-12(17)7-5-8-13(15)18/h3-10,19H,1-2H3,(H,20,21).
What are the key properties of 2-[2-(2,6-dichloroanilino)phenyl]-N-methylsulfonylpropanamide?
2-[2-(2,6-dichloroanilino)phenyl]-N-methylsulfonylpropanamide has a molecular weight of 387.29 g/mol, XLogP of 3.92, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,6-dichloroanilino)phenyl]-N-methylsulfonylpropanamide is sourced from PubChem (CID 45269894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).