About N-tert-butyl-2-[2-(2,6-dichloroanilino)phenyl]propanamide
N-tert-butyl-2-[2-(2,6-dichloroanilino)phenyl]propanamide (PubChem CID 45269895) has the molecular formula C19H22Cl2N2O
and a molecular weight of 365.30 g/mol. Its IUPAC name is N-tert-butyl-2-[2-(2,6-dichloroanilino)phenyl]propanamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-[2-(2,6-dichloroanilino)phenyl]propanamide |
| PubChem CID | 45269895 |
| Molecular Formula | C19H22Cl2N2O |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-tert-butyl-2-[2-(2,6-dichloroanilino)phenyl]propanamide |
| SMILES | CC(C(=O)NC(C)(C)C)c1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H22Cl2N2O/c1-12(18(24)23-19(2,3)4)13-8-5-6-11-16(13)22-17-14(20)9-7-10-15(17)21/h5-12,22H,1-4H3,(H,23,24) |
| InChIKey | YUOKWIGKXGRGFG-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-2-[2-(2,6-dichloroanilino)phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-[2-(2,6-dichloroanilino)phenyl]propanamide?
The IUPAC name of N-tert-butyl-2-[2-(2,6-dichloroanilino)phenyl]propanamide (CID 45269895) is N-tert-butyl-2-[2-(2,6-dichloroanilino)phenyl]propanamide.
What is the SMILES notation for N-tert-butyl-2-[2-(2,6-dichloroanilino)phenyl]propanamide?
The canonical SMILES for N-tert-butyl-2-[2-(2,6-dichloroanilino)phenyl]propanamide is CC(C(=O)NC(C)(C)C)c1ccccc1Nc1c(Cl)cccc1Cl.
What is the InChIKey of N-tert-butyl-2-[2-(2,6-dichloroanilino)phenyl]propanamide?
The InChIKey is YUOKWIGKXGRGFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22Cl2N2O/c1-12(18(24)23-19(2,3)4)13-8-5-6-11-16(13)22-17-14(20)9-7-10-15(17)21/h5-12,22H,1-4H3,(H,23,24).
What are the key properties of N-tert-butyl-2-[2-(2,6-dichloroanilino)phenyl]propanamide?
N-tert-butyl-2-[2-(2,6-dichloroanilino)phenyl]propanamide has a molecular weight of 365.30 g/mol, XLogP of 5.76, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-[2-(2,6-dichloroanilino)phenyl]propanamide is sourced from PubChem (CID 45269895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).