C23H36O7 — CID 45269923
[(1S,2R,4S,6S,9R,10S,13S,14R,15R,16R)-2,15,16-trihydroxy-14-(methoxymethyl)-5,5,9-trimethyl-12-oxo-6-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate (PubChem CID 45269923) has the molecular formula C23H36O7 and a molecular weight of 424.53 g/mol. Its IUPAC name is [(1S,2R,4S,6S,9R,10S,13S,14R,15R,16R)-2,15,16-trihydroxy-14-(methoxymethyl)-5,5,9-trimethyl-12-oxo-6-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate.
| Compound Name | [(1S,2R,4S,6S,9R,10S,13S,14R,15R,16R)-2,15,16-trihydroxy-14-(methoxymethyl)-5,5,9-trimethyl-12-oxo-6-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
|---|---|
| PubChem CID | 45269923 |
| Molecular Formula | C23H36O7 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | [(1S,2R,4S,6S,9R,10S,13S,14R,15R,16R)-2,15,16-trihydroxy-14-(methoxymethyl)-5,5,9-trimethyl-12-oxo-6-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
| SMILES | COC[C@H]1[C@@H]2C(=O)C[C@H]3[C@]4(C)CC[C@H](OC(C)=O)C(C)(C)[C@H]4C[C@@H](O)[C@@]3([C@@H]1O)[C@@H]2O |
| InChI | InChI=1S/C23H36O7/c1-11(24)30-17-6-7-22(4)14(21(17,2)3)9-16(26)23-15(22)8-13(25)18(20(23)28)12(10-29-5)19(23)27/h12,14-20,26-28H,6-10H2,1-5H3/t12-,14+,15-,16+,17-,18+,19+,20+,22+,23-/m0/s1 |
| InChIKey | VGLJFHNDCOXSLD-XXKYNMLDSA-N |
| XLogP | 1.31 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |