About 4-(4-methyl-3-oxo-1,2-oxazol-5-yl)-N-(2-phenylcyclopropyl)piperidine-1-carboxamide
4-(4-methyl-3-oxo-1,2-oxazol-5-yl)-N-(2-phenylcyclopropyl)piperidine-1-carboxamide (PubChem CID 45269948) has the molecular formula C19H23N3O3
and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-(4-methyl-3-oxo-1,2-oxazol-5-yl)-N-(2-phenylcyclopropyl)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(4-methyl-3-oxo-1,2-oxazol-5-yl)-N-(2-phenylcyclopropyl)piperidine-1-carboxamide |
| PubChem CID | 45269948 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 4-(4-methyl-3-oxo-1,2-oxazol-5-yl)-N-(2-phenylcyclopropyl)piperidine-1-carboxamide |
| SMILES | Cc1c(C2CCN(C(=O)NC3CC3c3ccccc3)CC2)o[nH]c1=O |
| InChI | InChI=1S/C19H23N3O3/c1-12-17(25-21-18(12)23)14-7-9-22(10-8-14)19(24)20-16-11-15(16)13-5-3-2-4-6-13/h2-6,14-16H,7-11H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | GQPZWGHDZGLONB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-methyl-3-oxo-1,2-oxazol-5-yl)-N-(2-phenylcyclopropyl)piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methyl-3-oxo-1,2-oxazol-5-yl)-N-(2-phenylcyclopropyl)piperidine-1-carboxamide?
The IUPAC name of 4-(4-methyl-3-oxo-1,2-oxazol-5-yl)-N-(2-phenylcyclopropyl)piperidine-1-carboxamide (CID 45269948) is 4-(4-methyl-3-oxo-1,2-oxazol-5-yl)-N-(2-phenylcyclopropyl)piperidine-1-carboxamide.
What is the SMILES notation for 4-(4-methyl-3-oxo-1,2-oxazol-5-yl)-N-(2-phenylcyclopropyl)piperidine-1-carboxamide?
The canonical SMILES for 4-(4-methyl-3-oxo-1,2-oxazol-5-yl)-N-(2-phenylcyclopropyl)piperidine-1-carboxamide is Cc1c(C2CCN(C(=O)NC3CC3c3ccccc3)CC2)o[nH]c1=O.
What is the InChIKey of 4-(4-methyl-3-oxo-1,2-oxazol-5-yl)-N-(2-phenylcyclopropyl)piperidine-1-carboxamide?
The InChIKey is GQPZWGHDZGLONB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O3/c1-12-17(25-21-18(12)23)14-7-9-22(10-8-14)19(24)20-16-11-15(16)13-5-3-2-4-6-13/h2-6,14-16H,7-11H2,1H3,(H,20,24)(H,21,23).
What are the key properties of 4-(4-methyl-3-oxo-1,2-oxazol-5-yl)-N-(2-phenylcyclopropyl)piperidine-1-carboxamide?
4-(4-methyl-3-oxo-1,2-oxazol-5-yl)-N-(2-phenylcyclopropyl)piperidine-1-carboxamide has a molecular weight of 341.41 g/mol, XLogP of 2.72, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methyl-3-oxo-1,2-oxazol-5-yl)-N-(2-phenylcyclopropyl)piperidine-1-carboxamide is sourced from PubChem (CID 45269948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).