C26H34N4O2 — CID 45270330
1-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-N-(oxan-4-ylmethyl)piperidin-4-amine (PubChem CID 45270330) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 1-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-N-(oxan-4-ylmethyl)piperidin-4-amine.
| Compound Name | 1-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-N-(oxan-4-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 45270330 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 1-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-N-(oxan-4-ylmethyl)piperidin-4-amine |
| SMILES | COc1ccc(Cn2c(N3CCC(NCC4CCOCC4)CC3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C26H34N4O2/c1-31-23-8-6-21(7-9-23)19-30-25-5-3-2-4-24(25)28-26(30)29-14-10-22(11-15-29)27-18-20-12-16-32-17-13-20/h2-9,20,22,27H,10-19H2,1H3 |
| InChIKey | NMEALLMQARPNTN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |