C26H23N2O5+ — CID 45270443
16,17-dimethoxy-21-(pyridin-2-ylmethoxy)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene (PubChem CID 45270443) has the molecular formula C26H23N2O5+ and a molecular weight of 443.48 g/mol. Its IUPAC name is 16,17-dimethoxy-21-(pyridin-2-ylmethoxy)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene.
| Compound Name | 16,17-dimethoxy-21-(pyridin-2-ylmethoxy)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
|---|---|
| PubChem CID | 45270443 |
| Molecular Formula | C26H23N2O5+ |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 16,17-dimethoxy-21-(pyridin-2-ylmethoxy)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
| SMILES | COc1ccc2c(OCc3ccccn3)c3[n+](cc2c1OC)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C26H23N2O5/c1-29-21-7-6-18-20(25(21)30-2)13-28-10-8-16-11-22-23(33-15-32-22)12-19(16)24(28)26(18)31-14-17-5-3-4-9-27-17/h3-7,9,11-13H,8,10,14-15H2,1-2H3/q+1 |
| InChIKey | HGYVPWNROOVWLS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 62.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|