C16H21ClO2 — CID 45270506
[(3Z,9Z,11E)-6-chlorotetradeca-3,9,11-trien-1-yn-7-yl] acetate (PubChem CID 45270506) has the molecular formula C16H21ClO2 and a molecular weight of 280.80 g/mol. Its IUPAC name is [(3Z,9Z,11E)-6-chlorotetradeca-3,9,11-trien-1-yn-7-yl] acetate.
| Compound Name | [(3Z,9Z,11E)-6-chlorotetradeca-3,9,11-trien-1-yn-7-yl] acetate |
|---|---|
| PubChem CID | 45270506 |
| Molecular Formula | C16H21ClO2 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | [(3Z,9Z,11E)-6-chlorotetradeca-3,9,11-trien-1-yn-7-yl] acetate |
| SMILES | C#C/C=C\CC(Cl)C(C/C=C\C=C\CC)OC(C)=O |
| InChI | InChI=1S/C16H21ClO2/c1-4-6-8-9-11-13-16(19-14(3)18)15(17)12-10-7-5-2/h2,6-11,15-16H,4,12-13H2,1,3H3/b8-6+,10-7-,11-9- |
| InChIKey | GJNIZHUDNBTUTM-FLZUSWORSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|