C17H18Cl2N2O — CID 45270570
3-[(2,4-dichlorophenoxy)-piperidin-4-ylmethyl]pyridine (PubChem CID 45270570) has the molecular formula C17H18Cl2N2O and a molecular weight of 337.25 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenoxy)-piperidin-4-ylmethyl]pyridine.
| Compound Name | 3-[(2,4-dichlorophenoxy)-piperidin-4-ylmethyl]pyridine |
|---|---|
| PubChem CID | 45270570 |
| Molecular Formula | C17H18Cl2N2O |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 3-[(2,4-dichlorophenoxy)-piperidin-4-ylmethyl]pyridine |
| SMILES | Clc1ccc(OC(c2cccnc2)C2CCNCC2)c(Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N2O/c18-14-3-4-16(15(19)10-14)22-17(12-5-8-20-9-6-12)13-2-1-7-21-11-13/h1-4,7,10-12,17,20H,5-6,8-9H2 |
| InChIKey | VKEVCZGXCJOVET-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |