C18H20O5 — CID 45270727
3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)-1,2,4,5-tetraoxane (PubChem CID 45270727) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)-1,2,4,5-tetraoxane.
| Compound Name | 3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)-1,2,4,5-tetraoxane |
|---|---|
| PubChem CID | 45270727 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 3-(4-methoxyphenyl)-6-(4-propan-2-ylphenyl)-1,2,4,5-tetraoxane |
| SMILES | COc1ccc(C2OOC(c3ccc(C(C)C)cc3)OO2)cc1 |
| InChI | InChI=1S/C18H20O5/c1-12(2)13-4-6-14(7-5-13)17-20-22-18(23-21-17)15-8-10-16(19-3)11-9-15/h4-12,17-18H,1-3H3 |
| InChIKey | CFNJHNJBIUXYJY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|