C27H31N5O4S — CID 45270753
10-[4-[4-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperazin-1-yl]butyl]phenothiazine-2-carboxylic acid (PubChem CID 45270753) has the molecular formula C27H31N5O4S and a molecular weight of 521.64 g/mol. Its IUPAC name is 10-[4-[4-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperazin-1-yl]butyl]phenothiazine-2-carboxylic acid.
| Compound Name | 10-[4-[4-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperazin-1-yl]butyl]phenothiazine-2-carboxylic acid |
|---|---|
| PubChem CID | 45270753 |
| Molecular Formula | C27H31N5O4S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 10-[4-[4-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperazin-1-yl]butyl]phenothiazine-2-carboxylic acid |
| SMILES | Cn1c(N2CCN(CCCCN3c4ccccc4Sc4ccc(C(=O)O)cc43)CC2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C27H31N5O4S/c1-28-24(18-25(33)29(2)27(28)36)31-15-13-30(14-16-31)11-5-6-12-32-20-7-3-4-8-22(20)37-23-10-9-19(26(34)35)17-21(23)32/h3-4,7-10,17-18H,5-6,11-16H2,1-2H3,(H,34,35) |
| InChIKey | UQAJLTTZWHXNJH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|