C21H27N5O — CID 45270813
3-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-2,5,7-trimethylimidazo[1,2-c]pyrimidine (PubChem CID 45270813) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is 3-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-2,5,7-trimethylimidazo[1,2-c]pyrimidine.
| Compound Name | 3-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-2,5,7-trimethylimidazo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 45270813 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 3-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-2,5,7-trimethylimidazo[1,2-c]pyrimidine |
| SMILES | COc1ccc(N2CCN(Cc3c(C)nc4cc(C)nc(C)n34)CC2)cc1 |
| InChI | InChI=1S/C21H27N5O/c1-15-13-21-23-16(2)20(26(21)17(3)22-15)14-24-9-11-25(12-10-24)18-5-7-19(27-4)8-6-18/h5-8,13H,9-12,14H2,1-4H3 |
| InChIKey | LPJGAZGHYONJPC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 45.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|