C15H22O4 — CID 45270814
(1S,2S,4R,12S,13S)-4,9,13-trimethyl-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadecan-14-one (PubChem CID 45270814) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1S,2S,4R,12S,13S)-4,9,13-trimethyl-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadecan-14-one.
| Compound Name | (1S,2S,4R,12S,13S)-4,9,13-trimethyl-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadecan-14-one |
|---|---|
| PubChem CID | 45270814 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (1S,2S,4R,12S,13S)-4,9,13-trimethyl-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadecan-14-one |
| SMILES | C[C@@H]1C(=O)O[C@H]2[C@H]1CCC1(C)OC1CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C15H22O4/c1-8-9-4-6-14(2)10(18-14)5-7-15(3)12(19-15)11(9)17-13(8)16/h8-12H,4-7H2,1-3H3/t8-,9-,10?,11-,12-,14?,15+/m0/s1 |
| InChIKey | NQJVZXLJUUTCFR-DDFCETJDSA-N |
| XLogP | 2.05 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|