C20H25NO8 — CID 45270845
(2R,3R,4S,5S,6R)-2-[(3,4-dihydroxyphenyl)methyl-phenylmethoxyamino]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 45270845) has the molecular formula C20H25NO8 and a molecular weight of 407.42 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(3,4-dihydroxyphenyl)methyl-phenylmethoxyamino]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[(3,4-dihydroxyphenyl)methyl-phenylmethoxyamino]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 45270845 |
| Molecular Formula | C20H25NO8 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(3,4-dihydroxyphenyl)methyl-phenylmethoxyamino]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](N(Cc2ccc(O)c(O)c2)OCc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H25NO8/c22-10-16-17(25)18(26)19(27)20(29-16)21(28-11-12-4-2-1-3-5-12)9-13-6-7-14(23)15(24)8-13/h1-8,16-20,22-27H,9-11H2/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | SGKBFZBORQFPGT-OUUBHVDSSA-N |
| XLogP | -0.17 |
| TPSA | 143.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|