About 2,3-diphenyl-6-pyrrolidin-1-ylthieno[2,3-b]pyridin-4-amine
2,3-diphenyl-6-pyrrolidin-1-ylthieno[2,3-b]pyridin-4-amine (PubChem CID 45270866) has the molecular formula C23H21N3S
and a molecular weight of 371.51 g/mol. Its IUPAC name is 2,3-diphenyl-6-pyrrolidin-1-ylthieno[2,3-b]pyridin-4-amine.
Molecular Properties
| Compound Name | 2,3-diphenyl-6-pyrrolidin-1-ylthieno[2,3-b]pyridin-4-amine |
| PubChem CID | 45270866 |
| Molecular Formula | C23H21N3S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2,3-diphenyl-6-pyrrolidin-1-ylthieno[2,3-b]pyridin-4-amine |
| SMILES | Nc1cc(N2CCCC2)nc2sc(-c3ccccc3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C23H21N3S/c24-18-15-19(26-13-7-8-14-26)25-23-21(18)20(16-9-3-1-4-10-16)22(27-23)17-11-5-2-6-12-17/h1-6,9-12,15H,7-8,13-14H2,(H2,24,25) |
| InChIKey | YFZQDFGECVJTQN-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-diphenyl-6-pyrrolidin-1-ylthieno[2,3-b]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diphenyl-6-pyrrolidin-1-ylthieno[2,3-b]pyridin-4-amine?
The IUPAC name of 2,3-diphenyl-6-pyrrolidin-1-ylthieno[2,3-b]pyridin-4-amine (CID 45270866) is 2,3-diphenyl-6-pyrrolidin-1-ylthieno[2,3-b]pyridin-4-amine.
What is the SMILES notation for 2,3-diphenyl-6-pyrrolidin-1-ylthieno[2,3-b]pyridin-4-amine?
The canonical SMILES for 2,3-diphenyl-6-pyrrolidin-1-ylthieno[2,3-b]pyridin-4-amine is Nc1cc(N2CCCC2)nc2sc(-c3ccccc3)c(-c3ccccc3)c12.
What is the InChIKey of 2,3-diphenyl-6-pyrrolidin-1-ylthieno[2,3-b]pyridin-4-amine?
The InChIKey is YFZQDFGECVJTQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3S/c24-18-15-19(26-13-7-8-14-26)25-23-21(18)20(16-9-3-1-4-10-16)22(27-23)17-11-5-2-6-12-17/h1-6,9-12,15H,7-8,13-14H2,(H2,24,25).
What are the key properties of 2,3-diphenyl-6-pyrrolidin-1-ylthieno[2,3-b]pyridin-4-amine?
2,3-diphenyl-6-pyrrolidin-1-ylthieno[2,3-b]pyridin-4-amine has a molecular weight of 371.51 g/mol, XLogP of 5.81, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphenyl-6-pyrrolidin-1-ylthieno[2,3-b]pyridin-4-amine is sourced from PubChem (CID 45270866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).