C31H26ClN3O2 — CID 45270876
2-[5-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]acetic acid (PubChem CID 45270876) has the molecular formula C31H26ClN3O2 and a molecular weight of 508.02 g/mol. Its IUPAC name is 2-[5-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]acetic acid.
| Compound Name | 2-[5-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]acetic acid |
|---|---|
| PubChem CID | 45270876 |
| Molecular Formula | C31H26ClN3O2 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 2-[5-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]acetic acid |
| SMILES | O=C(O)CN1CCc2c(c3ccccc3n2Cc2cccc(/C=C/c3ccc4ccc(Cl)cc4n3)c2)C1 |
| InChI | InChI=1S/C31H26ClN3O2/c32-24-11-9-23-10-13-25(33-28(23)17-24)12-8-21-4-3-5-22(16-21)18-35-29-7-2-1-6-26(29)27-19-34(20-31(36)37)15-14-30(27)35/h1-13,16-17H,14-15,18-20H2,(H,36,37)/b12-8+ |
| InChIKey | WDOGIYXRQBGYAH-XYOKQWHBSA-N |
| XLogP | 6.50 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|