C17H19F4N3 — CID 45270917
cis-(1S,3R)-N-[[1,4-dimethyl-5-(3,4,5-trifluorophenyl)pyrazol-3-yl]methyl]-3-fluorocyclopentan-1-amine (PubChem CID 45270917) has the molecular formula C17H19F4N3 and a molecular weight of 341.35 g/mol. Its IUPAC name is cis-(1S,3R)-N-[[1,4-dimethyl-5-(3,4,5-trifluorophenyl)pyrazol-3-yl]methyl]-3-fluorocyclopentan-1-amine.
| Compound Name | cis-(1S,3R)-N-[[1,4-dimethyl-5-(3,4,5-trifluorophenyl)pyrazol-3-yl]methyl]-3-fluorocyclopentan-1-amine |
|---|---|
| PubChem CID | 45270917 |
| Molecular Formula | C17H19F4N3 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | cis-(1S,3R)-N-[[1,4-dimethyl-5-(3,4,5-trifluorophenyl)pyrazol-3-yl]methyl]-3-fluorocyclopentan-1-amine |
| SMILES | Cc1c(CN[C@H]2CC[C@@H](F)C2)nn(C)c1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C17H19F4N3/c1-9-15(8-22-12-4-3-11(18)7-12)23-24(2)17(9)10-5-13(19)16(21)14(20)6-10/h5-6,11-12,22H,3-4,7-8H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | LLSBPKPNVGJBRE-NEPJUHHUSA-N |
| XLogP | 3.79 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|