About N-[[1-(2,3-dimethylphenyl)indazol-5-yl]methyl]-2-propylpentanamide
N-[[1-(2,3-dimethylphenyl)indazol-5-yl]methyl]-2-propylpentanamide (PubChem CID 45270944) has the molecular formula C24H31N3O
and a molecular weight of 377.53 g/mol. Its IUPAC name is N-[[1-(2,3-dimethylphenyl)indazol-5-yl]methyl]-2-propylpentanamide.
Molecular Properties
| Compound Name | N-[[1-(2,3-dimethylphenyl)indazol-5-yl]methyl]-2-propylpentanamide |
| PubChem CID | 45270944 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | N-[[1-(2,3-dimethylphenyl)indazol-5-yl]methyl]-2-propylpentanamide |
| SMILES | CCCC(CCC)C(=O)NCc1ccc2c(cnn2-c2cccc(C)c2C)c1 |
| InChI | InChI=1S/C24H31N3O/c1-5-8-20(9-6-2)24(28)25-15-19-12-13-23-21(14-19)16-26-27(23)22-11-7-10-17(3)18(22)4/h7,10-14,16,20H,5-6,8-9,15H2,1-4H3,(H,25,28) |
| InChIKey | HVOPXEDYTXZCJZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[1-(2,3-dimethylphenyl)indazol-5-yl]methyl]-2-propylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(2,3-dimethylphenyl)indazol-5-yl]methyl]-2-propylpentanamide?
The IUPAC name of N-[[1-(2,3-dimethylphenyl)indazol-5-yl]methyl]-2-propylpentanamide (CID 45270944) is N-[[1-(2,3-dimethylphenyl)indazol-5-yl]methyl]-2-propylpentanamide.
What is the SMILES notation for N-[[1-(2,3-dimethylphenyl)indazol-5-yl]methyl]-2-propylpentanamide?
The canonical SMILES for N-[[1-(2,3-dimethylphenyl)indazol-5-yl]methyl]-2-propylpentanamide is CCCC(CCC)C(=O)NCc1ccc2c(cnn2-c2cccc(C)c2C)c1.
What is the InChIKey of N-[[1-(2,3-dimethylphenyl)indazol-5-yl]methyl]-2-propylpentanamide?
The InChIKey is HVOPXEDYTXZCJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31N3O/c1-5-8-20(9-6-2)24(28)25-15-19-12-13-23-21(14-19)16-26-27(23)22-11-7-10-17(3)18(22)4/h7,10-14,16,20H,5-6,8-9,15H2,1-4H3,(H,25,28).
What are the key properties of N-[[1-(2,3-dimethylphenyl)indazol-5-yl]methyl]-2-propylpentanamide?
N-[[1-(2,3-dimethylphenyl)indazol-5-yl]methyl]-2-propylpentanamide has a molecular weight of 377.53 g/mol, XLogP of 5.47, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(2,3-dimethylphenyl)indazol-5-yl]methyl]-2-propylpentanamide is sourced from PubChem (CID 45270944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).