C29H30N4O — CID 45271073
N-(2-aminophenyl)-7,7-bis(1H-indol-3-yl)heptanamide (PubChem CID 45271073) has the molecular formula C29H30N4O and a molecular weight of 450.59 g/mol. Its IUPAC name is N-(2-aminophenyl)-7,7-bis(1H-indol-3-yl)heptanamide.
| Compound Name | N-(2-aminophenyl)-7,7-bis(1H-indol-3-yl)heptanamide |
|---|---|
| PubChem CID | 45271073 |
| Molecular Formula | C29H30N4O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | N-(2-aminophenyl)-7,7-bis(1H-indol-3-yl)heptanamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCC(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H30N4O/c30-25-13-6-9-16-28(25)33-29(34)17-3-1-2-10-20(23-18-31-26-14-7-4-11-21(23)26)24-19-32-27-15-8-5-12-22(24)27/h4-9,11-16,18-20,31-32H,1-3,10,17,30H2,(H,33,34) |
| InChIKey | KJPFZGOXSBMBCC-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|