C24H25FN2O2S — CID 45271135
2-(cyclohexylmethyl)-4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)pyrimidine (PubChem CID 45271135) has the molecular formula C24H25FN2O2S and a molecular weight of 424.54 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)pyrimidine.
| Compound Name | 2-(cyclohexylmethyl)-4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)pyrimidine |
|---|---|
| PubChem CID | 45271135 |
| Molecular Formula | C24H25FN2O2S |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-(cyclohexylmethyl)-4-(4-fluorophenyl)-5-(4-methylsulfonylphenyl)pyrimidine |
| SMILES | CS(=O)(=O)c1ccc(-c2cnc(CC3CCCCC3)nc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H25FN2O2S/c1-30(28,29)21-13-9-18(10-14-21)22-16-26-23(15-17-5-3-2-4-6-17)27-24(22)19-7-11-20(25)12-8-19/h7-14,16-17H,2-6,15H2,1H3 |
| InChIKey | KSCDBBDAERUVEP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |