C23H20BrN3O4 — CID 45271192
5-(3-bromophenyl)-8-(furan-2-yl)-1,3-dimethyl-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 45271192) has the molecular formula C23H20BrN3O4 and a molecular weight of 482.33 g/mol. Its IUPAC name is 5-(3-bromophenyl)-8-(furan-2-yl)-1,3-dimethyl-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | 5-(3-bromophenyl)-8-(furan-2-yl)-1,3-dimethyl-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 45271192 |
| Molecular Formula | C23H20BrN3O4 |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | 5-(3-bromophenyl)-8-(furan-2-yl)-1,3-dimethyl-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)C(c1cccc(Br)c1)C1=C(CC(c3ccco3)CC1=O)N2 |
| InChI | InChI=1S/C23H20BrN3O4/c1-26-21-20(22(29)27(2)23(26)30)18(12-5-3-6-14(24)9-12)19-15(25-21)10-13(11-16(19)28)17-7-4-8-31-17/h3-9,13,18,25H,10-11H2,1-2H3 |
| InChIKey | GIZQRVDABPMVFV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 86.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |