C18H33N7O3S — CID 45271209
7-[3-[4-(3-aminopropylamino)butylamino]propylamino]-N,N-dimethyl-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 45271209) has the molecular formula C18H33N7O3S and a molecular weight of 427.58 g/mol. Its IUPAC name is 7-[3-[4-(3-aminopropylamino)butylamino]propylamino]-N,N-dimethyl-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | 7-[3-[4-(3-aminopropylamino)butylamino]propylamino]-N,N-dimethyl-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 45271209 |
| Molecular Formula | C18H33N7O3S |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 7-[3-[4-(3-aminopropylamino)butylamino]propylamino]-N,N-dimethyl-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NCCCNCCCCNCCCN)c2nonc12 |
| InChI | InChI=1S/C18H33N7O3S/c1-25(2)29(26,27)16-8-7-15(17-18(16)24-28-23-17)22-14-6-13-21-11-4-3-10-20-12-5-9-19/h7-8,20-22H,3-6,9-14,19H2,1-2H3 |
| InChIKey | MLIIFECPJZCAMR-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 138.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|