About N-ethyl-N'-[3-[3-(2-methylprop-2-enylamino)propylamino]propyl]propane-1,3-diamine
N-ethyl-N'-[3-[3-(2-methylprop-2-enylamino)propylamino]propyl]propane-1,3-diamine (PubChem CID 45271264) has the molecular formula C15H34N4
and a molecular weight of 270.46 g/mol. Its IUPAC name is N-ethyl-N'-[3-[3-(2-methylprop-2-enylamino)propylamino]propyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N-ethyl-N'-[3-[3-(2-methylprop-2-enylamino)propylamino]propyl]propane-1,3-diamine |
| PubChem CID | 45271264 |
| Molecular Formula | C15H34N4 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.28 |
| IUPAC Name | N-ethyl-N'-[3-[3-(2-methylprop-2-enylamino)propylamino]propyl]propane-1,3-diamine |
| SMILES | C=C(C)CNCCCNCCCNCCCNCC |
| InChI | InChI=1S/C15H34N4/c1-4-16-8-5-9-17-10-6-11-18-12-7-13-19-14-15(2)3/h16-19H,2,4-14H2,1,3H3 |
| InChIKey | KUYUWQQKSDQJBP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-[3-[3-(2-methylprop-2-enylamino)propylamino]propyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-[3-[3-(2-methylprop-2-enylamino)propylamino]propyl]propane-1,3-diamine?
The IUPAC name of N-ethyl-N'-[3-[3-(2-methylprop-2-enylamino)propylamino]propyl]propane-1,3-diamine (CID 45271264) is N-ethyl-N'-[3-[3-(2-methylprop-2-enylamino)propylamino]propyl]propane-1,3-diamine.
What is the SMILES notation for N-ethyl-N'-[3-[3-(2-methylprop-2-enylamino)propylamino]propyl]propane-1,3-diamine?
The canonical SMILES for N-ethyl-N'-[3-[3-(2-methylprop-2-enylamino)propylamino]propyl]propane-1,3-diamine is C=C(C)CNCCCNCCCNCCCNCC.
What is the InChIKey of N-ethyl-N'-[3-[3-(2-methylprop-2-enylamino)propylamino]propyl]propane-1,3-diamine?
The InChIKey is KUYUWQQKSDQJBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H34N4/c1-4-16-8-5-9-17-10-6-11-18-12-7-13-19-14-15(2)3/h16-19H,2,4-14H2,1,3H3.
What are the key properties of N-ethyl-N'-[3-[3-(2-methylprop-2-enylamino)propylamino]propyl]propane-1,3-diamine?
N-ethyl-N'-[3-[3-(2-methylprop-2-enylamino)propylamino]propyl]propane-1,3-diamine has a molecular weight of 270.46 g/mol, XLogP of 1.11, 15 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-[3-[3-(2-methylprop-2-enylamino)propylamino]propyl]propane-1,3-diamine is sourced from PubChem (CID 45271264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).