C25H34F6N4S2 — CID 45271271
N,N'-bis[3-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]propyl]propane-1,3-diamine (PubChem CID 45271271) has the molecular formula C25H34F6N4S2 and a molecular weight of 568.70 g/mol. Its IUPAC name is N,N'-bis[3-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]propyl]propane-1,3-diamine.
| Compound Name | N,N'-bis[3-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 45271271 |
| Molecular Formula | C25H34F6N4S2 |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | N,N'-bis[3-[[4-(trifluoromethylsulfanyl)phenyl]methylamino]propyl]propane-1,3-diamine |
| SMILES | FC(F)(F)Sc1ccc(CNCCCNCCCNCCCNCc2ccc(SC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C25H34F6N4S2/c26-24(27,28)36-22-8-4-20(5-9-22)18-34-16-2-14-32-12-1-13-33-15-3-17-35-19-21-6-10-23(11-7-21)37-25(29,30)31/h4-11,32-35H,1-3,12-19H2 |
| InChIKey | YLZUJWFZVZSOSK-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|