C22H28N4O2 — CID 45271284
2-piperazin-1-yl-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide (PubChem CID 45271284) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-piperazin-1-yl-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide.
| Compound Name | 2-piperazin-1-yl-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
|---|---|
| PubChem CID | 45271284 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2-piperazin-1-yl-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
| SMILES | Cc1cn(-c2ccc(C(N)=O)c(N3CCNCC3)c2)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C22H28N4O2/c1-14-13-26(18-11-22(2,3)12-19(27)20(14)18)15-4-5-16(21(23)28)17(10-15)25-8-6-24-7-9-25/h4-5,10,13,24H,6-9,11-12H2,1-3H3,(H2,23,28) |
| InChIKey | NSOZPPFBKUFLAJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |