C24H35NO — CID 45271307
(1S,3R,6S,11S,12S,15E,16S)-15-ethylidene-12,16-dimethyl-6-(methylamino)-7-methylidenepentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-one (PubChem CID 45271307) has the molecular formula C24H35NO and a molecular weight of 353.55 g/mol. Its IUPAC name is (1S,3R,6S,11S,12S,15E,16S)-15-ethylidene-12,16-dimethyl-6-(methylamino)-7-methylidenepentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-one.
| Compound Name | (1S,3R,6S,11S,12S,15E,16S)-15-ethylidene-12,16-dimethyl-6-(methylamino)-7-methylidenepentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-one |
|---|---|
| PubChem CID | 45271307 |
| Molecular Formula | C24H35NO |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | (1S,3R,6S,11S,12S,15E,16S)-15-ethylidene-12,16-dimethyl-6-(methylamino)-7-methylidenepentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-one |
| SMILES | C=C1C2CC[C@@H]3[C@]4(CC[C@]5(C)/C(=C\C)C(=O)C[C@@]35C)C[C@]24CC[C@@H]1NC |
| InChI | InChI=1S/C24H35NO/c1-6-16-19(26)13-22(4)20-8-7-17-15(2)18(25-5)9-10-23(17)14-24(20,23)12-11-21(16,22)3/h6,17-18,20,25H,2,7-14H2,1,3-5H3/b16-6-/t17?,18-,20-,21+,22-,23+,24-/m0/s1 |
| InChIKey | RGADTGZXHGYDQJ-QOLDVVLXSA-N |
| XLogP | 5.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|