About N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-4-(2-methoxyphenoxy)benzenesulfonamide
N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-4-(2-methoxyphenoxy)benzenesulfonamide (PubChem CID 45271421) has the molecular formula C24H18N2O4S3
and a molecular weight of 494.62 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-4-(2-methoxyphenoxy)benzenesulfonamide.
Molecular Properties
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-4-(2-methoxyphenoxy)benzenesulfonamide |
| PubChem CID | 45271421 |
| Molecular Formula | C24H18N2O4S3 |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-4-(2-methoxyphenoxy)benzenesulfonamide |
| SMILES | COc1ccccc1Oc1ccc(S(=O)(=O)Nc2sccc2-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C24H18N2O4S3/c1-29-20-7-3-4-8-21(20)30-16-10-12-17(13-11-16)33(27,28)26-24-18(14-15-31-24)23-25-19-6-2-5-9-22(19)32-23/h2-15,26H,1H3 |
| InChIKey | VGNNIFNQPBNSMB-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-4-(2-methoxyphenoxy)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-4-(2-methoxyphenoxy)benzenesulfonamide?
The IUPAC name of N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-4-(2-methoxyphenoxy)benzenesulfonamide (CID 45271421) is N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-4-(2-methoxyphenoxy)benzenesulfonamide.
What is the SMILES notation for N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-4-(2-methoxyphenoxy)benzenesulfonamide?
The canonical SMILES for N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-4-(2-methoxyphenoxy)benzenesulfonamide is COc1ccccc1Oc1ccc(S(=O)(=O)Nc2sccc2-c2nc3ccccc3s2)cc1.
What is the InChIKey of N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-4-(2-methoxyphenoxy)benzenesulfonamide?
The InChIKey is VGNNIFNQPBNSMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N2O4S3/c1-29-20-7-3-4-8-21(20)30-16-10-12-17(13-11-16)33(27,28)26-24-18(14-15-31-24)23-25-19-6-2-5-9-22(19)32-23/h2-15,26H,1H3.
What are the key properties of N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-4-(2-methoxyphenoxy)benzenesulfonamide?
N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-4-(2-methoxyphenoxy)benzenesulfonamide has a molecular weight of 494.62 g/mol, XLogP of 6.63, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1,3-benzothiazol-2-yl)thiophen-2-yl]-4-(2-methoxyphenoxy)benzenesulfonamide is sourced from PubChem (CID 45271421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).