C19H21N3O7S — CID 45271432
(4-nitrophenyl)methyl (5S,6S)-7-oxo-6-[(1R)-1-(propan-2-ylcarbamoyloxy)ethyl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 45271432) has the molecular formula C19H21N3O7S and a molecular weight of 435.46 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5S,6S)-7-oxo-6-[(1R)-1-(propan-2-ylcarbamoyloxy)ethyl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5S,6S)-7-oxo-6-[(1R)-1-(propan-2-ylcarbamoyloxy)ethyl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 45271432 |
| Molecular Formula | C19H21N3O7S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (4-nitrophenyl)methyl (5S,6S)-7-oxo-6-[(1R)-1-(propan-2-ylcarbamoyloxy)ethyl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(C)NC(=O)O[C@H](C)[C@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=CS[C@@H]12 |
| InChI | InChI=1S/C19H21N3O7S/c1-10(2)20-19(25)29-11(3)15-16(23)21-14(9-30-17(15)21)18(24)28-8-12-4-6-13(7-5-12)22(26)27/h4-7,9-11,15,17H,8H2,1-3H3,(H,20,25)/t11-,15+,17+/m1/s1 |
| InChIKey | XQNRPEQMQSBDMJ-PJQXDXOGSA-N |
| XLogP | 2.53 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|