C38H42F3N3O5 — CID 45271476
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-5-(4-fluorophenoxy)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 45271476) has the molecular formula C38H42F3N3O5 and a molecular weight of 677.76 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-5-(4-fluorophenoxy)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-5-(4-fluorophenoxy)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 45271476 |
| Molecular Formula | C38H42F3N3O5 |
| Molecular Weight | 677.76 g/mol |
| Exact Mass | 677.31 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-5-(4-fluorophenoxy)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(Oc2ccc(F)cc2)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNCc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C38H42F3N3O5/c1-4-13-44(14-5-2)38(47)28-19-27(20-34(21-28)49-32-11-9-29(39)10-12-32)37(46)43-35(18-26-15-30(40)22-31(41)16-26)36(45)24-42-23-25-7-6-8-33(17-25)48-3/h6-12,15-17,19-22,35-36,42,45H,4-5,13-14,18,23-24H2,1-3H3,(H,43,46)/t35-,36+/m0/s1 |
| InChIKey | JETJWGUSWYCCER-MPQUPPDSSA-N |
| XLogP | 6.66 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.76 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |