C23H36N2O7 — CID 45271678
(E)-but-2-enedioic acid;(1S,2S,4R,7E,11S,12R)-12-[(2-tert-butylhydrazinyl)methyl]-4,8-dimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one (PubChem CID 45271678) has the molecular formula C23H36N2O7 and a molecular weight of 452.55 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(1S,2S,4R,7E,11S,12R)-12-[(2-tert-butylhydrazinyl)methyl]-4,8-dimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one.
| Compound Name | (E)-but-2-enedioic acid;(1S,2S,4R,7E,11S,12R)-12-[(2-tert-butylhydrazinyl)methyl]-4,8-dimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
|---|---|
| PubChem CID | 45271678 |
| Molecular Formula | C23H36N2O7 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | (E)-but-2-enedioic acid;(1S,2S,4R,7E,11S,12R)-12-[(2-tert-butylhydrazinyl)methyl]-4,8-dimethyl-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
| SMILES | C/C1=C\CC[C@@]2(C)O[C@H]2[C@H]2OC(=O)[C@@H](CNNC(C)(C)C)[C@@H]2CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H32N2O3.C4H4O4/c1-12-7-6-10-19(5)16(24-19)15-13(9-8-12)14(17(22)23-15)11-20-21-18(2,3)4;5-3(6)1-2-4(7)8/h7,13-16,20-21H,6,8-11H2,1-5H3;1-2H,(H,5,6)(H,7,8)/b12-7+;2-1+/t13-,14-,15-,16-,19+;/m0./s1 |
| InChIKey | HXXRHQUAACYUIB-KWJQBKATSA-N |
| XLogP | 2.43 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|