C21H22N2O7 — CID 45271703
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-(4-phenylmethoxyphenyl)-1,2,4-oxadiazol-5-yl]oxane-3,4,5-triol (PubChem CID 45271703) has the molecular formula C21H22N2O7 and a molecular weight of 414.41 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-(4-phenylmethoxyphenyl)-1,2,4-oxadiazol-5-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-(4-phenylmethoxyphenyl)-1,2,4-oxadiazol-5-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 45271703 |
| Molecular Formula | C21H22N2O7 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-(4-phenylmethoxyphenyl)-1,2,4-oxadiazol-5-yl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2nc(-c3ccc(OCc4ccccc4)cc3)no2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H22N2O7/c24-10-15-16(25)17(26)18(27)19(29-15)21-22-20(23-30-21)13-6-8-14(9-7-13)28-11-12-4-2-1-3-5-12/h1-9,15-19,24-27H,10-11H2/t15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | PNOXTLIMCPQSNZ-UJWQCDCRSA-N |
| XLogP | 0.83 |
| TPSA | 138.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |