C17H19N5O — CID 45271764
1-[2-(1H-pyrazol-4-ylmethylamino)ethyl]-3,7,8,9-tetrahydropyrrolo[3,2-f]isoquinolin-6-one (PubChem CID 45271764) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-[2-(1H-pyrazol-4-ylmethylamino)ethyl]-3,7,8,9-tetrahydropyrrolo[3,2-f]isoquinolin-6-one.
| Compound Name | 1-[2-(1H-pyrazol-4-ylmethylamino)ethyl]-3,7,8,9-tetrahydropyrrolo[3,2-f]isoquinolin-6-one |
|---|---|
| PubChem CID | 45271764 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 1-[2-(1H-pyrazol-4-ylmethylamino)ethyl]-3,7,8,9-tetrahydropyrrolo[3,2-f]isoquinolin-6-one |
| SMILES | O=C1NCCc2c1ccc1[nH]cc(CCNCc3cn[nH]c3)c21 |
| InChI | InChI=1S/C17H19N5O/c23-17-14-1-2-15-16(13(14)4-6-19-17)12(10-20-15)3-5-18-7-11-8-21-22-9-11/h1-2,8-10,18,20H,3-7H2,(H,19,23)(H,21,22) |
| InChIKey | GBNXZKUIQKSFDY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|