About 6-fluoro-3-(4-methylphenyl)-2H-1,4-benzoxazine
6-fluoro-3-(4-methylphenyl)-2H-1,4-benzoxazine (PubChem CID 45271769) has the molecular formula C15H12FNO
and a molecular weight of 241.27 g/mol. Its IUPAC name is 6-fluoro-3-(4-methylphenyl)-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 6-fluoro-3-(4-methylphenyl)-2H-1,4-benzoxazine |
| PubChem CID | 45271769 |
| Molecular Formula | C15H12FNO |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 6-fluoro-3-(4-methylphenyl)-2H-1,4-benzoxazine |
| SMILES | Cc1ccc(C2=Nc3cc(F)ccc3OC2)cc1 |
| InChI | InChI=1S/C15H12FNO/c1-10-2-4-11(5-3-10)14-9-18-15-7-6-12(16)8-13(15)17-14/h2-8H,9H2,1H3 |
| InChIKey | YRIBTDQQZHHWJH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-3-(4-methylphenyl)-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3-(4-methylphenyl)-2H-1,4-benzoxazine?
The IUPAC name of 6-fluoro-3-(4-methylphenyl)-2H-1,4-benzoxazine (CID 45271769) is 6-fluoro-3-(4-methylphenyl)-2H-1,4-benzoxazine.
What is the SMILES notation for 6-fluoro-3-(4-methylphenyl)-2H-1,4-benzoxazine?
The canonical SMILES for 6-fluoro-3-(4-methylphenyl)-2H-1,4-benzoxazine is Cc1ccc(C2=Nc3cc(F)ccc3OC2)cc1.
What is the InChIKey of 6-fluoro-3-(4-methylphenyl)-2H-1,4-benzoxazine?
The InChIKey is YRIBTDQQZHHWJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12FNO/c1-10-2-4-11(5-3-10)14-9-18-15-7-6-12(16)8-13(15)17-14/h2-8H,9H2,1H3.
What are the key properties of 6-fluoro-3-(4-methylphenyl)-2H-1,4-benzoxazine?
6-fluoro-3-(4-methylphenyl)-2H-1,4-benzoxazine has a molecular weight of 241.27 g/mol, XLogP of 3.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3-(4-methylphenyl)-2H-1,4-benzoxazine is sourced from PubChem (CID 45271769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).