About 1-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1-methyl-3,3-dipropylurea
1-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1-methyl-3,3-dipropylurea (PubChem CID 45271789) has the molecular formula C22H27FN4O
and a molecular weight of 382.48 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1-methyl-3,3-dipropylurea.
Molecular Properties
| Compound Name | 1-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1-methyl-3,3-dipropylurea |
| PubChem CID | 45271789 |
| Molecular Formula | C22H27FN4O |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1-methyl-3,3-dipropylurea |
| SMILES | CCCN(CCC)C(=O)N(C)Cc1ccc2c(cnn2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H27FN4O/c1-4-12-26(13-5-2)22(28)25(3)16-17-6-11-21-18(14-17)15-24-27(21)20-9-7-19(23)8-10-20/h6-11,14-15H,4-5,12-13,16H2,1-3H3 |
| InChIKey | ZMTBBWOKUQUMRJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1-methyl-3,3-dipropylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1-methyl-3,3-dipropylurea?
The IUPAC name of 1-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1-methyl-3,3-dipropylurea (CID 45271789) is 1-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1-methyl-3,3-dipropylurea.
What is the SMILES notation for 1-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1-methyl-3,3-dipropylurea?
The canonical SMILES for 1-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1-methyl-3,3-dipropylurea is CCCN(CCC)C(=O)N(C)Cc1ccc2c(cnn2-c2ccc(F)cc2)c1.
What is the InChIKey of 1-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1-methyl-3,3-dipropylurea?
The InChIKey is ZMTBBWOKUQUMRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27FN4O/c1-4-12-26(13-5-2)22(28)25(3)16-17-6-11-21-18(14-17)15-24-27(21)20-9-7-19(23)8-10-20/h6-11,14-15H,4-5,12-13,16H2,1-3H3.
What are the key properties of 1-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1-methyl-3,3-dipropylurea?
1-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1-methyl-3,3-dipropylurea has a molecular weight of 382.48 g/mol, XLogP of 4.84, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1-methyl-3,3-dipropylurea is sourced from PubChem (CID 45271789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).