C21H30F3N3O2 — CID 45271813
N-[[(2S)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]pyrrolidin-2-yl]methyl]-N,2,2-trimethylpropanamide (PubChem CID 45271813) has the molecular formula C21H30F3N3O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-[[(2S)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]pyrrolidin-2-yl]methyl]-N,2,2-trimethylpropanamide.
| Compound Name | N-[[(2S)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]pyrrolidin-2-yl]methyl]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 45271813 |
| Molecular Formula | C21H30F3N3O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | N-[[(2S)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]pyrrolidin-2-yl]methyl]-N,2,2-trimethylpropanamide |
| SMILES | CN(C[C@@H]1CCCN1C(=O)C[C@H](N)Cc1cc(F)c(F)cc1F)C(=O)C(C)(C)C |
| InChI | InChI=1S/C21H30F3N3O2/c1-21(2,3)20(29)26(4)12-15-6-5-7-27(15)19(28)10-14(25)8-13-9-17(23)18(24)11-16(13)22/h9,11,14-15H,5-8,10,12,25H2,1-4H3/t14-,15+/m1/s1 |
| InChIKey | LJFJRWMOMVPQNG-CABCVRRESA-N |
| XLogP | 2.86 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|