C24H29N5O2 — CID 45271830
N-[2-methoxy-4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]phenyl]butanamide (PubChem CID 45271830) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[2-methoxy-4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]phenyl]butanamide.
| Compound Name | N-[2-methoxy-4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]phenyl]butanamide |
|---|---|
| PubChem CID | 45271830 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-[2-methoxy-4-[6-(1-pyridin-3-ylbutylamino)pyrazin-2-yl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(-c2cncc(NC(CCC)c3cccnc3)n2)cc1OC |
| InChI | InChI=1S/C24H29N5O2/c1-4-7-19(18-9-6-12-25-14-18)27-23-16-26-15-21(28-23)17-10-11-20(22(13-17)31-3)29-24(30)8-5-2/h6,9-16,19H,4-5,7-8H2,1-3H3,(H,27,28)(H,29,30) |
| InChIKey | VDFNEYLYERKZKT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |