C17H21N3O3S — CID 45271890
(3S)-9-methoxy-3-(morpholin-4-ylmethyl)-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepin-5-one (PubChem CID 45271890) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is (3S)-9-methoxy-3-(morpholin-4-ylmethyl)-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepin-5-one.
| Compound Name | (3S)-9-methoxy-3-(morpholin-4-ylmethyl)-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 45271890 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (3S)-9-methoxy-3-(morpholin-4-ylmethyl)-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepin-5-one |
| SMILES | COc1ccc2sc3c(c2c1)NC[C@@H](CN1CCOCC1)NC3=O |
| InChI | InChI=1S/C17H21N3O3S/c1-22-12-2-3-14-13(8-12)15-16(24-14)17(21)19-11(9-18-15)10-20-4-6-23-7-5-20/h2-3,8,11,18H,4-7,9-10H2,1H3,(H,19,21)/t11-/m0/s1 |
| InChIKey | WYNKVGUYVKMILG-NSHDSACASA-N |
| XLogP | 1.77 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |