About N-(2-tert-butylimidazo[1,2-a]pyridin-6-yl)-4-[4-(trifluoromethyl)phenyl]benzamide
N-(2-tert-butylimidazo[1,2-a]pyridin-6-yl)-4-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 45271907) has the molecular formula C25H22F3N3O
and a molecular weight of 437.47 g/mol. Its IUPAC name is N-(2-tert-butylimidazo[1,2-a]pyridin-6-yl)-4-[4-(trifluoromethyl)phenyl]benzamide.
Molecular Properties
| Compound Name | N-(2-tert-butylimidazo[1,2-a]pyridin-6-yl)-4-[4-(trifluoromethyl)phenyl]benzamide |
| PubChem CID | 45271907 |
| Molecular Formula | C25H22F3N3O |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-(2-tert-butylimidazo[1,2-a]pyridin-6-yl)-4-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CC(C)(C)c1cn2cc(NC(=O)c3ccc(-c4ccc(C(F)(F)F)cc4)cc3)ccc2n1 |
| InChI | InChI=1S/C25H22F3N3O/c1-24(2,3)21-15-31-14-20(12-13-22(31)30-21)29-23(32)18-6-4-16(5-7-18)17-8-10-19(11-9-17)25(26,27)28/h4-15H,1-3H3,(H,29,32) |
| InChIKey | YQQGXMBZQVEFAU-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-tert-butylimidazo[1,2-a]pyridin-6-yl)-4-[4-(trifluoromethyl)phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-tert-butylimidazo[1,2-a]pyridin-6-yl)-4-[4-(trifluoromethyl)phenyl]benzamide?
The IUPAC name of N-(2-tert-butylimidazo[1,2-a]pyridin-6-yl)-4-[4-(trifluoromethyl)phenyl]benzamide (CID 45271907) is N-(2-tert-butylimidazo[1,2-a]pyridin-6-yl)-4-[4-(trifluoromethyl)phenyl]benzamide.
What is the SMILES notation for N-(2-tert-butylimidazo[1,2-a]pyridin-6-yl)-4-[4-(trifluoromethyl)phenyl]benzamide?
The canonical SMILES for N-(2-tert-butylimidazo[1,2-a]pyridin-6-yl)-4-[4-(trifluoromethyl)phenyl]benzamide is CC(C)(C)c1cn2cc(NC(=O)c3ccc(-c4ccc(C(F)(F)F)cc4)cc3)ccc2n1.
What is the InChIKey of N-(2-tert-butylimidazo[1,2-a]pyridin-6-yl)-4-[4-(trifluoromethyl)phenyl]benzamide?
The InChIKey is YQQGXMBZQVEFAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22F3N3O/c1-24(2,3)21-15-31-14-20(12-13-22(31)30-21)29-23(32)18-6-4-16(5-7-18)17-8-10-19(11-9-17)25(26,27)28/h4-15H,1-3H3,(H,29,32).
What are the key properties of N-(2-tert-butylimidazo[1,2-a]pyridin-6-yl)-4-[4-(trifluoromethyl)phenyl]benzamide?
N-(2-tert-butylimidazo[1,2-a]pyridin-6-yl)-4-[4-(trifluoromethyl)phenyl]benzamide has a molecular weight of 437.47 g/mol, XLogP of 6.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-tert-butylimidazo[1,2-a]pyridin-6-yl)-4-[4-(trifluoromethyl)phenyl]benzamide is sourced from PubChem (CID 45271907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).